Physics, 18.10.2019 17:30 hiene

Which statement best describes an effect of using a catalyst in an industrial process?
it lowers energy requirements.
it increases waste.
it increases toxic exhaust.
it lowers production rates.

Answers: 1

Show answers

Answers

Answer from: quece233

Option (a) is the correct answer.

Explanation:

Catalyst are the species or substances which helps in increasing the rate of a reaction without itself getting consumed in the reaction.

A catalyst lowers the activation energy so that molecules with low energy can easily participate in the chemical reaction and hence product formation becomes faster.

Thus, we can conclude that the statement it lowers energy requirements best describes an effect of using a catalyst in an industrial process.

Answer from: Quest

hello there!

your answer is a “generator”

a generator does not create energy but instead it transforms it.

it’s basically a motor working in reverse.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 23:00

Aray of light traveling parallel to the principal axis of a concave mirror will be reflected through the mirror's

Answers: 2

Answer

Physics, 22.06.2019 01:30

What is the magnitude of the resultant vector round your answer to the nearest tenth

Answers: 2

Answer

Physics, 22.06.2019 02:10

Astudent is performing an experiment comparing sound and light waves. the student gathers the following data. what conclusion does the student most likely make based on this data? light waves always travel the same speed; however, the speed of sound is determined by the medium that it travels through. all sound waves always have the same energy, so the temperature of the medium does not affect wave speed. light needs to vibrate particles, so it travels fastest in tightly packed solids, while sound does not need a medium, so it travels fastest in a gas. tightly packed particles in solids slow down the light waves; however, sound waves make particles bounce into each other, so they travel faster in solids.

Answers: 3

Answer

Physics, 22.06.2019 03:30

When a spring is compressed, the energy changes from kinetic to potential. which best describes what is causing this change? work power gravitational energy chemical energy

Answers: 3

Answer

You know the right answer?

Which statement best describes an effect of using a catalyst in an industrial process?
it lo...

Questions