Physics, 30.01.2020 17:03 Wanna14ever

Select all that apply. what is true about the elements of a period?

Answers: 3

Show answers

Answers

All of the elements in a period have the same number of atomic orbitals. For example, every element in the top row (the first period) has one orbital for its electrons. All of the elements in the second row (the second period) have two orbitals for their electrons.

Answer from: Quest

this allows people to make the best decision or pursue the best option. when alternatives are weighed using their advantages and disadvantages, the option whose disadvantages outweigh the advantages (based on a qualitative or quantitative analysis) are shunned while those whose advantages outweigh their disadvantages are pursued.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 20.06.2019 18:04

Me ! mark u as brainlest! the speed of a sound wave depends on question 7 options: a) the frequency. b)the medium. c)the air temperature. d)both air temperature and medium.

Answers: 2

Answer

Physics, 22.06.2019 09:50

Gordon is going for a run through the park, but it is cold outside. the low outside temperature could affect his personal safety.

Answers: 1

Answer

Physics, 22.06.2019 18:30

Daughter element the new element produced along with a decay particle in a nuclear transmutation 2. half-life the substance that decays in a nuclear transmutation 3. parent element the change of one chemical element into another by nuclear decay or radioactive bombardment 4. transmutation the time required for the decay of one-half of the atoms in a sample of radioactive material

Answers: 2

Answer

Physics, 22.06.2019 19:50

What are the dimensions of the cross section that passes through the points a, f, g, and d?