Physics, 07.10.2019 23:30 kaliyab191

What is the momentum of a 5 kg object that has a velocity of 1.2 m/s?

Answers: 2

Show answers

Answers

In the given question all the required details are given. Using these information's a person can easily find the momentum of the object. In the question it is already given that the mass of the object is 5 kg and the velocity at which it is traveling is 1.2 m/s.
We know the equation of finding momentum as
Momentum = mass * velocity
= 5 * 1.2
= 6
So the momentum of the object is 6 Newton.

Answer from: tareas7009

P = 6 kg m/s

Explanation:

Momentum of an object is given by the product of mass and velocity. Any object in motion has momentum.

It is given by:

P = m v

where m is the mass and v is the velocity.

Here, m = 5 kg

v = 1.2 m/s

Thus, P = m v = 5 kg × 1.2 m/s² = 6 kg.m/s²

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

find the surface area of the sphere to the nearest square unit. use a calculator.

a. 254 in.2

b. 64 in.2

c. 127 in.2

d. 1,018 in.2

Another question on Physics

Physics, 22.06.2019 05:30

Acombination reaction is when two or more combine to form one product. a decomposition reaction is when a substance breaks down into two or more simpler substances in a chemical reaction.

Answers: 1

Answer

Physics, 22.06.2019 08:00

What is a carrier wave and how does it affect what you hear on the radio

Answers: 1

Answer

Physics, 22.06.2019 11:30

Why is the energy that results from a roller coaster's position at the top of a hill referred to as potential energy?

Answers: 1

Answer

Physics, 22.06.2019 12:30

An engine undergoes a cycle as shown in the diagram. during a complete cycle the work done by the gas is 28.5×103 j and the energy transferred thermally out is 99.4×103 j. there are 1.5×1024 gas molecules and they have three active degrees of freedom. 6. (6 pts) during which process(es) is energy transferred thermally into the gas? a. 1→2 b. 2→3 c. 4→1 d. 1→2 and 4→1 e. none of the above