What would happen to an organism if it's lung cells stopped functioning properly? a) other organ systems would take over to ensure that the lungs continued functioning. b) the respiratory system would fail, and then the entire organism would suffer. c) the respiratory system would fail, but that would not impact any other systems or the organism itself. d)

B) The respiratory system would fail, and then the entire organism would suffer.

Cells are basically the basic units of life. Organisms are made up of cells that carry out metabolic reactions in which energy is given off to the organism. Without the energy produced by the cells the organisms organs will not function as well therefore leading to a possible death for the organism. Cells have many other functions that are vital for the organism to grow as well function properly. Cells help the organism gain oxygen throughout the body therefore if no oxygen is present due to if the cells were to stop working the organism would die. Long story short cells are vital for the survival of the organism otherwise that organism would face death.

So that would be B) The respiratory system would fail, and then the entire organism would suffer. 
Hope this helped! ☺

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

3x + 2x = both people using the same measure of like 5x = x= 25 meters per second. 25ms. it takes them 4 seconds to