Physics, 25.08.2021 07:30 doggylover8655

Why frequency remains unchanged during reflection

Answers: 3

Show answers

Answers

Although the wave slows down, its frequency remains the same, due to the fact that its wavelength is shorter. When waves travel from one medium to another the frequency never changes. As waves travel into the denser medium, they slow down and wavelength decreases.

Answer from: mutesheep

When waves travel from one medium to another the frequency never changes.

Explanation:

As waves travel into the denser medium, they slow down and wavelength decreases. Part of the wave travels faster for longer causing the wave to turn. The wave is slower but the wavelength is shorter meaning frequency remains the same.

Answer from: Quest

34535543; (; ; $

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 05:30

Which of the following are considered noble gases? a. bromine b. neon c. argon d. chlorine

Answers: 1

Answer

Physics, 22.06.2019 08:30

Hey student studies gravity using objects that have the same mass which two objects have the greatest gravitational force acting between them a. 100kg 1.0m 100kg b. 100kg 2.0m 100kg c. 100kg 2.0m 100kg big d. 100kg big 3.0m 100kg big

Answers: 1

Answer

Physics, 22.06.2019 11:30

In a good thermo flask the main cause of heat loss is

Answers: 1

Answer

Physics, 22.06.2019 14:00

The mantle is made up of which structural zones?

Answers: 1

Answer

You know the right answer?

Why frequency remains unchanged during reflection...