Physics, 03.06.2021 17:40 angeles86

Calculate the current an electric clothes dryer praws when it is connected to a 230 V source ands has a resistance of 9.2

What is the resistance in a circuit if a potential difference of 110 V causes a current of 10 A?

Calculate the current an electric clothes dryer praws when it is connected to a 230 V

source ands

Answers: 3

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

connect the batteries in series and hope

Answer from: Quest

the answer is ampere

the ampere is used to measure electricity. an ampere is a unit of electric current equal. a unit of measure for the flow of current in a circuit. one ampere is the amount of current flow provided when one volt of electrical pressure is applied against one ohm of resistance.

Answer from: Quest

speed of light in vacuum is 300,000 km/s

speed of light in other mediums is given by the expression v = c/n, where c is the speed of light in vacuum and n is the refractive index of medium.

for the first medium v = 200,000 km/s

so, refractive index of medium = 300000/200000 = 1.5

1.5 refractive index is usually for glass. so first medium is glass.

for the second medium v = 250,00 km/s

so, refractive index of medium = 300000/250000 = 1.2

1.2 refractive index is usually for water. so second medium is water.

for the third medium v = 0 km/s

so, refractive index of medium = 300000/0 = ∞

∞ refractive index is usually for opaque mediums. so third medium is opaque medium.

Another question on Physics

Physics, 22.06.2019 08:00

What is a good example of instantaneous speed

Answers: 2

Answer

Physics, 22.06.2019 14:30

Exercise 2. find the wavelength of a photon emitted when an electron jumps from the n = 3 energy level down to the n = 2 energy level. where is this photon in the electromagnetic spectrum?

Answers: 3

Answer

Physics, 22.06.2019 14:30

What distance does a car travel as its speed changes from 0 to 20 m/s in 17 s at constant acceleration?

Answers: 1

Answer

Physics, 22.06.2019 15:40

Apotter's wheel moves uniformly from rest to an angular speed of 0.20 rev/s in 32.0 s. (a) find its angular acceleration in radians per second per second. rad/s2 (b) would doubling the angular acceleration during the given period have doubled final angular speed?

Answers: 1

Answer

You know the right answer?

Calculate the current an electric clothes dryer praws when it is connected to a 230 V source ands h...

Questions