On Apollo Moon missions, the lunar module would blast off from the Moon's surface and dock with the command module in lunar orbit. After docking, the lunar module would be jettisoned and allowed to crash back onto the lunar surface. Seismometers placed on the Moon's surface by the astronauts would then pick up the resulting seismic waves. Find the impact speed of the lunar module, given that it is jettisoned from an orbit 110 km above the lunar surface moving with a speed of 1600 m/s .
My Approach:
Ei = Ef
1/2*m*vi2 - (G*m*ME)/(radius of moon + orbital distance) = 1/2*m*vf2 ​- (G*m*ME)/r
=> (0.5 * m * 16002) - (6.67 * 10-11 * 7.35*1022 * m/(1737.4*103 +180*103) = (0.5*m*v^2) - (6.67*10-11 * 7.35*1022 * m/(1737.4*103 )

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

The objects are acted upon by only one force. gravity. mass times the acceleration of gravity (-9.81meters/second squared).

Answerthe global climate during the paleogene departed from the hot and humid conditions of the late mesozoic era and began a cooling and drying trend which dispite having been periodically disrupted by warm periods such as the paleocene-eocene thermal maximum, persists today;