Plzzz help In this activity you will complete a virtual experiment to determine how the temperature of water affect the time it takes for antacid tablets to dissolve. Read over the lab report before you begin. If you choose to conduct this experiment by setting it up at home, then please review the lab safety guide in the Course Information section before you begin. Keep in mind you may use the video in the lesson to record the reaction times. Pre-lab Questions: (10 points) questions
1. How does an increase in concentration affect a chemical reaction?

2. When temperature increases, what happens to the molecules in a chemical reaction?

3. How do we measure the average kinetic motion of molecules in a solution?​

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Fitness is the ability to perform only very light levels of physical activity.

Molybdeum(mo)orruthenium (ru)actually, elements with similar chemical properties as technetium would bemn, re, and bh. this is because elements in the same group/family (column) have similar chemical properties. elements in the same period (row) have the same number of energy levels (or shells).