Physics, 28.01.2020 22:03 coreyslotte

What's the formula for acceleration when force is included.

Answers: 3

Show answers

Answers

Answer from: sabrinarasull1pe6s61

Acceleration of an object =

(the net force acting on it)
divided by
(its mass) .

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Answer: a charge of -1.0 × 10⁻⁴ c must be placed at x = 26 m.the sign of the charge will be the same sign as the -4.0 µc charge.======electricstatic force between two point charges is given by $f = \dfrac{kq_1q_2}{r^2}$ where k is coulomb's constant, 8.99×10⁹ n·m²/c², q₁ and q₂ are the point charges, and r is the distance between the two point charges.assign positive to q₁let q₁ = 6.0 µc, q₂ = -4.0 µc, q₀ represent the charge at the origin, and q₃ represent this new charge to place.the charge at the origin q₀ would experience the following force f₀₁ from q₁, with r = 6.0 m (note that 1 µc = 10⁻⁶ c) $f_{01} = \dfrac{kq_0q_1}{(\text{6.0 m})^2}$ the force from q₂ $f_{02} = \dfrac{kq_0q_2}{(\text{15 m})^2}$ the force from q₃ $f_{03} = \dfrac{kq_0q_1}{(\text{26 m})^2}$ the net force on the origin charge, q₀, has to be zero for no electrostatic forcehaving an equation where k and q₀ can be divided out of the equation will allow us to solve for q₃ $\begin{aligned} f_{net} & = 0\\ f_{01} + f_{02} + f_{03} & = 0 \\ \dfrac{kq_0q_1}{(\text{6.0 m})^2} + \dfrac{kq_0q_2}{(\text{15 m})^2} + \dfrac{kq_0q_3}{(\text{26 m})^2} & = 0 \\ kq_0 \left( \dfrac{q_1}{(\text{6.0 m})^2} + \dfrac{q_2}{(\text{15 m})^2} + \dfrac{q_3}{(\text{26 m})^2}\right) & = 0 \\ \dfrac{q_1}{(\text{6.0 m})^2} + \dfrac{q_2}{(\text{15 m})^2} + \dfrac{q_3}{(\text{26 m})^2} & = 0 \end{aligned}$ isolating: $\begin{aligned} \dfrac{q_3}{(\text{26 m})^2} & = -\dfrac{q_1}{(\text{6.0 m})^2} - \dfrac{q_2}{(\text{15 m})^2} \\ q_3 & = -(\text{26 m})^2\left(\dfrac{q_1}{(\text{6.0 m})^2} + \dfrac{q_2}{(\text{15 m})^2}\right) \\ q_3 & = -(\text{26 m})^2\left(\dfrac{6.0\times10^{-6} \text{ c}}{(\text{6.0 m})^2} + \dfrac{-4.0\times10^{-6} \text{ c}}{(\text{15 m})^2}\right) \\ q_3 & = -1.0064888 \times 10^{-4}\text{ c} \\ q_3 & = -1.0\times 10^{-4}\text{ c} \end{aligned}$ a charge of -1.0 × 10⁻⁴ c must be placed at x = 26 m.the sign of the charge will be the same as the -4.0 µc charge

Another question on Physics

Physics, 22.06.2019 05:00

The earth is constantly spinning on its axis, like you might spin a basketball on your finger. it is this spinning of the earth that causes

Answers: 3

Answer

Physics, 22.06.2019 11:10

Consider an insulating crystal, made up of layers of atoms. what form would you expect the temperature dependence of the phonon heat capacity to approach at extremely low temperatures if the interlayer coupling is i)very strong (rigid coupling), and ii) very weak. explain.

Answers: 3

Answer

Physics, 22.06.2019 17:00

What does the law of conservation of mass state?

Answers: 2

Answer

Physics, 22.06.2019 17:40

Which describes an object in projectile motion? check all that apply.a.gravity acts to pull the object downb.the object moves in a straight path.c.the forward velocity of the object is 0 m/s.d.the object’s inertia carries it forward.e.the path of the object is curved.

Answers: 2

Answer

You know the right answer?

What's the formula for acceleration when force is included....

Questions