One day you’re reading a popular diet blog, in which the author claims that if all you do is simply drink a sufficient amount of ice water every day, you could lose as much as half a pound each week. The claim is that your body must warm the ice water from 0°C to the body temperature of 37°C and that takes energy at the expense of body fat. Thankfully, you just finished discussing heat in your physics class, so you can calculate how much energy is expended in drinking ice water and how much fat will be lost. A) How much energy, in kilocalories, is required to warm 2.2 liters of ice water from 0°C to 37°C?
Q =

B) Assuming it takes 3300 kcal to “burn” one pound of fat, how many pounds could you lose per week just by drinking 2.2 L of ice water every day?
mfat = 0.4

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Ithink the answer would be 1,350!

Answer8.0m;

The fertilized egg  begins to develop into a hollow ball of cells called the blastocyst.