Physics, 05.03.2021 14:00 lindseybug

Can someone plz explain : Two cars have the same mass, the first car is moving towards the east and the second is
stationary. If the two cars merge together after a collision and head towards the east their speed
after the collision is equal to
A)1/4vi b)1/2vi c)vi d) 2vi

Answers: 1

Show answers

Answers

Answer from: catsareokiguess

Option b, the final velocity is half of the initial velocity.

Explanation:

Here we will use the conservation of the total momentum of a system.

This means that the total momentum at the beginning must be the same as the final momentum.

Where momentum is:

P = M*v

Initially, we have two cars, both with the same mass M, and only one of them has a velocity v.

Then the initial momentum is:

P = M*v + M*0 = M*v

After the collision, the two cars move together. Then the total mass that is moving is equal to the sum of the masses of the cars, this is 2*M

and we can suppose that the two cars move at a final velocity v'

Then the final momentum is:

P' = (2*M)*v'

Now we use the conservation of momentum, then:

P = P'

M*v = (2*M)*v'

Now we need to solve this for v'

(M*v)/(2*M) = v'

v/2 = v'

This means that the final velocity is half of the initial velocity.

Then the correct option is option b.

Answer from: Quest

uranium fissions/breaks up giving out energy and neutrons

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 19:00

Yardım edin lütfen uzun cevap lazım çok puan veriyorum

Answers: 1

Answer

Physics, 22.06.2019 05:00

Asmall 21 kilogram canoe is floating downriver at a speed of 1 m/s. what is the canoe's kinetic energy?

Answers: 1

Answer

Physics, 22.06.2019 09:30

Acar drives toward the right over the top of a hill, as shown below. which arrow represents the centripetal acceleration? w x y z

Answers: 3

Answer

Physics, 22.06.2019 11:00

Although longitudinal waves can travel through all media types what is the disadvantage of this type of wave transmission? a) he efficiency of he wave transmission is greatly diminished as the media becomes less dense b) the oscillation of one set of particles has a huge impact on neighboring particles c) particles become too close together as they bump into each other making it more likely to hit other particles down the line

Answers: 2

Answer

You know the right answer?

Can someone plz explain : Two cars have the same mass, the first car is moving towards the east and...

Questions