Physics, 25.02.2021 22:40 arielpraczko1

If it takes him 0.2 seconds to throw the ball from rest,
then what is the final velocity?

Answers: 2

Show answers

Answers

Answer from: Quest

acceleration = (change in speed) / (time for the change)

change in speed = (20-120)= -100 m/s.

1.5 min = 90 sec

acceleration = -100/90 = -1.11 m/s^2.

we don't care about the 150kg or the 2,500 meters. they don't make any difference.

read more on -

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

radiation

explanation:

heat is transmitted by radiation

Answer from: Quest

the minimum constant speed at which she can catch the train is 2.7 m/s

given:

acceleration = 0.6 $\frac{m}{s^{2} }$

time = 4.5 s

to find:

velocity = ?

formula used:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

solution:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

v = 0 + (0.6 × 4.5)

v = 2.7 m/s

the minimum constant speed at which she can catch the train is 2.7 m/s

Another question on Physics

Physics, 22.06.2019 06:00

Explain earth's motion, using the terms "precession" and "rotation" in your answer.

Answers: 1

Answer

Physics, 22.06.2019 11:20

Sound is a disturbance that travels through a medium as a

Answers: 1

Answer

Physics, 22.06.2019 13:00

Ways that industry and agriculture use physical properties to separate substances

Answers: 1

Answer

Physics, 22.06.2019 17:30

Atruck driver is attempting to deliver some furniture. first, he travels 8 km east, and then he turns around and travels 3 km west. finally, he turns again and travels 13 km to his destination. what is the drivers total displacement?