Physics, 05.11.2020 04:40 milly1903

A vector of components (6, 2) is multiplied by the scalar value of 3. What is the magnitude and direction of the resultant vector?

Answers: 3

Show answers

Answers

Answer from: hey9691

18.97∡18.43

Explanation:

To find the magnitude of this vector we have to use the Pythagorean theorem, since we have the magnitudes on the X & y axes.

x = 6

y = 2

$d=\sqrt{x^{2} +y^{2} }\\d = \sqrt{6^{2} +2^{2} }\\d = 6.32$

After multiplying the magnitude by 3 we have:

D = 6.32*3

D = 18.97

The direction of the vector doesn't change only the magnitude

tan(α) = 2/6

α = tan⁻¹(2/6)

α = 18.43°

So the first vector is equal to: 6.32∡18.43

and the second vector is: 18.97∡18.43

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

well, you would divide 135 by 33 to get your answer. then that is how many seconds it would take. boardman should fly about 132 m or 4.090909090909091 seconds.

Another question on Physics

Physics, 22.06.2019 21:00

Acentrifuge in a medical laboratory rotates at an angular speed of 3,700 rev/min. when switched off, it rotates through 54.0 revolutions before coming to rest. find the constant angular acceleration (in rad/s2) of the centrifuge. your response is within 10% of the correct value. this may be due to roundoff error, or you could have a mistake in your calculation. carry out all intermediate results to at least four-digit accuracy to minimize roundoff error. rad/s2

Answers: 1

Answer

Physics, 22.06.2019 22:30

When you hold a rectangular object, how does the area of the side that is resting on your hand affect the pressure and the force that the object exerts?

Answers: 3

Answer

Physics, 22.06.2019 23:10

What was the purpose of the apollo program? to put a man in orbit to launch a spy satellite to launch a space station to put man on the moon

Answers: 1

Answer

Physics, 23.06.2019 01:30

Aplane's average speed between two cities is 600 km/h. if the trip takes 2.5 hours, how far does the plane fly?

Answers: 2

Answer

You know the right answer?

A vector of components (6, 2) is multiplied by the scalar value of 3. What is the magnitude and dire...