Physics, 14.10.2020 14:01 bxymichelle

What is the mass of a 5 kg bag of flour on the moon?

Answers: 1

Show answers

Answers

Answer from: ariqueen

mass = 5 [kg]

Explanation:

The difference between weight and mass should be clarified, the weight is equal to the product of the mass by the gravity of the place. While the mass will always be conserved regardless of the place, it will never change.

weight = mass * gravity of the place

}Therefore the mass is the same in the earth as in the moon

Answer from: Quest

the largest known star in the universe is uy scuti, a hypergiant with a radius around 1,700 times larger than the sun.jul 26, 2018

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 22:10

How would doubling the made of an object change the objects potential energy

Answers: 2

Answer

Physics, 22.06.2019 08:50

Mga halaman/punong ornamental na di namumulaklak

Answers: 1

Answer

Physics, 22.06.2019 18:00

Wind and moving water provide energy. question 1 options: chemical mechanical thermal none of the above

Answers: 1

Answer

Physics, 22.06.2019 18:30

Asled is being held at rest on a slope that makes an angle θ with the horizontal. after the sled is released, it slidesa distance d1 down the slope and then covers the distance d2 alongthe horizontal terrain before stopping. find the coefficient ofkinetic friction μk between the sled and the ground, assumingthat it is constant throughout the trip. find the coefficient of kinetic frictionμk. express your answer in terms of someor all of the variables d1, d2, and θ.