An object with a mass of 6300 g has a force of 7.1 Newtons applied to it. What is the resulting acceleration of the object?

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Distance covered = speed x timethe distance traveled going against the stream = distance traveled with the stream.therefore it is the speed and the time that are the variables.as he travels the same distance both ways, speed x time is the same for each way.going upstream his speed is 4 kph; going downstream his speed is 6 kph.therefore we have two simultaneous equations: time upstream x 4 = time downstream x 6time upstream + time downstream = 60 minutestherefore we have the equation: time upstream = 6/10 hour, time downstream therefore = 4/10 hour.distance traveled at 4km/hr in 6/10 hour = 24/10 = 2.4km.check: distance traveled at 6km/hr in 4/10 hour = 24/10 = 2.4km.

Stars are born within the clouds of dust and scattered throughout most galaxies. a familiar example of such as a dust cloud is the orion nebula. turbulence deep within these clouds gives rise to knots with sufficient mass that the gas and dust can begin to collapse under its own gravitational attraction. as the cloud collapses, the material at the center begins to heat up. known as a protostar, it is this hot core at the heart of the collapsing cloud that will one day become a star. three-dimensional computer models of star formation predict that the spinning clouds of collapsing gas and dust may break up into two or three blobs; this would explain why the majority the stars in the milky way are paired or in groups of multiple stars.therefor, i would say the answer is: dust and gases contract.i hope this ! < 3

Friction force is equal to the net force of the car.             fn                           |ff< ·                       |                     fgfg and fn cancel out.55 km/h is 15.2778 m/s. this is the initial velocityfinal velocity is 0 m/sfind acceleration using kinematic equationv² = v₀² + 2adsince v = 00 = v₀² + 2ada = -v₀²/(2d)a = -(15.2778 m/s)/(2 * 38m) a = -3.2418 m/s²find net force and you find friction.f = ma f = (1165 .2418 m/s²)f = 3776.7 n = ffw = ff · dw = (3776.7 n)(38 m)w = -1.4 × 10^5 jthe friction forces do 1.4 × 10^5 j of work on the car