Physics, 14.02.2020 01:02 kaleahearly123

Explain how VSEPR theory predicts the shapes of molecules. Match the words in the left column to the appropriate blanks in the sentences on the right. Make certain each sentence is complete before submitting your answer.

Answers: 2

Show answers

Answers

Answer from: eternity88091

The VSEPR theory and how it predicts the shapes of molecules:

Explanation:

The Valence Shell Electron Pair Repulsion (VSEPR) theory is a model used in chemistry to predict the shapes of individual molecules by the number of electron pairs that they have in the center of the atom. This theory is also based on the notion that the electrons around the atom repel one another. The Valence electrons on the outermost layer of the molecule are the most important in defining the geometry as they are the first to interact with other atoms and will be involved in bonding.

Answer from: Quest

it takes about 30 days for it to break down

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 23:30

An object starts from rest at point f and speeds up continuously as it moves around an oval. a. choose a point about 1/8 th of the way around the oval from point f, and label it point g. draw a vector to represent the velocity of the object at point g. b. determine the change in velocity vector between points f and g.

Answers: 1

Answer

Physics, 22.06.2019 15:10

When electrons are added to the outermost shell of a carbon atom, it forms--an anion that has a larger anion that has a smaller cation that has a larger cation that has a smaller radius.

Answers: 3

Answer

Physics, 22.06.2019 15:20

Your science teacher brings in a speaker to talk to your class about climate change. during the session, students ask a few questions. which questions are related to the current evidence on climate change

Answers: 3

Answer

Physics, 22.06.2019 17:50

If there's a small amount of friction between two surfaces, the result could be select all that applya. no movement b. heatc. a little bit of movementd. sliding around

Answers: 2

Answer

You know the right answer?

Explain how VSEPR theory predicts the shapes of molecules. Match the words in the left column to the...

Questions