Physics, 14.11.2019 22:31 chackey

Andrea and chuck are riding on a merry-go-round. andrea rides on a horse at the outer rim of the circular platform, twice as far from the center of the circular platform as chuck, who rides on an inner horse. when the merry-go-round is rotating at a constant angular speed, andrea's tangential speed is which of the following? a) twice chuck's b) the same as chuck's c) half of chuck's d) impossible to determine b. when the merry go round is rotating at a constant angular speed, andrea's tangential speed is a) twice chuck's b) the same as chuck's

Answers: 2

Show answers

Answers

Answer from: ijohnh14

a) Twice Chuck's

Explanation:

If the angular speed is constant, as the merry - go -round is a rigid body, so the distance between two points must remain the same, it is needed that the points farther the center, move faster than the ones closer to it.

There exists a relationship between tangential and angular speed, as follows, that relates the definitions of linear and angular speed, and the angle definition:

angle = arc / radius ⇒ Δθ/Δt = Δs/Δt / r ⇒ ω = v/r ⇒ v = ω. r

If ω is constant, v is directly proportional to r, distance to the center (radius in a circular platform), so if r is twice for Andrea, her tangential speed must be twice Chuck's.

Answer from: Quest

electrical power

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 22:00

What happens to the light rays when they hit the specimen?

Answers: 1

Answer

Physics, 22.06.2019 15:20

Talia is manufacturing rolls of wire for hanging pictures. she needs a material that is so that it can easily be pulled into wire without breaking.

Answers: 2

Answer

Physics, 23.06.2019 01:00

The smallest particle of an element that retains its identity in a chemical reaction. true or false

Answers: 1

Answer

Physics, 23.06.2019 02:00

Answer asap 50 points which of the following illustrates how a venus fly trap senses that an insect has landed in its open leaves? 1. using tiny hairs, the leaves sense a change in light. 2. using tiny hairs, the leaves taste a chemical. 3. using tiny hairs, the leaves detect a touch. 4. using tiny hairs, the leaves sense a change in water levels.

Answers: 1

Answer

You know the right answer?

Andrea and chuck are riding on a merry-go-round. andrea rides on a horse at the outer rim of the cir...

Questions