Physics, 22.09.2019 06:30 cchotshot

The common value for the speed of light in a vacuum is:
3.00 × 106m/s
3.00 × 108m/s
3.00 × 1010m/s
3.00 × 1012m/s

Answers: 1

Show answers

Answers

Answer from: kenzie530

The common value for “Speed of light in vacuum” is $\bold{3 \times 10^{8}}$ metre per second.

Option b

Solution:

Speed of light can be defined as the speed with which light waves propagate in different medium. In vacuum, speed of light is 186,282 miles per second or 299,792 km/s which is rounded off as $3 \times 10^{8} \mathrm{m} / \mathrm{s}$ .

“Speed of light in vacuum” is a universal constant and usually represented by ‘c’. Light waves travels at a speed of $3 \times 10^{8}$ metre per second in vacuum.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

3. dark matter

empty space could also be a simple vacuum

Another question on Physics

Physics, 22.06.2019 17:20

You charge a parallel-plate capacitor, remove it from the battery, and prevent the wires connected to the plates from touching each other. when you increase the plate separation, what happens to the following quantities?

Answers: 1

Answer

Physics, 23.06.2019 02:30

Aproton is shot from the negative disk toward the positive disk. what launch speed must the proton have to just barely reach the positive disk?

Answers: 2

Answer

Physics, 23.06.2019 06:10

In 1859, charles darwin published the first edition of on the origin of species, which explained his observations of various groups of animals that showed great similarities but minor differences. darwin concluded that if a population of one species separates into two different populations that live in separate locations, then over the course of many generations the different populations can develop into different species. this idea predicted many future biological findings and became the basis of modern biology. darwin’s explanation for why different species exist is best described as a(n) law. theory. inquiry. hypothesis.

Answers: 1

Answer

Physics, 23.06.2019 07:00

Acircuit contain a 5-ohm,a3-ohm,and an 8-ohm resistor in series. what is the total resistance of the circuit

Answers: 2

Answer

You know the right answer?

The common value for the speed of light in a vacuum is:
3.00 × 106m/s
3.00 × 108m/s <...

Questions