Physics, 24.08.2019 03:30 trejoste1

Discuss the limitations of using the doppler shift to determine an object's speed.

Answers: 2

Show answers

Answers

Answer from: hartzpeyton136

Answer and Explanation:

Limitation of Doppler shift :

The Doppler impact is relevant when the speeds of the wellspring of sound and spectator are considerably less than the speed of sound. The movement of both the spectator and the source is along a similar straight line.When movement is not in straight line or velocity is not much less than speed of light then we can not use Doppler shift

This is the limitation of Doppler shift to determine the object distance

Answer from: Quest

explanation:

there is no change in the electric potential energy as it is in rest on both conditions.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 08:30

What object a collides with object b and bounces back its final momentum is?

Answers: 1

Answer

Physics, 22.06.2019 12:50

Match each vocabulary term to its definition. 1. electrons neutral subatomic particles found in the nucleus of the atom 2. neutron lowest energy position of an electron in an atom 3. photon the path of an electron around the nucleus of an atom 4. ground state negatively charged, subatomic particles 5. protons packet of energy of specific size 6. element substance with only one type of atom 7. orbital positively charged, subatomic particles found in the nucleus of the atom

Answers: 1

Answer

Physics, 22.06.2019 14:00

Ascientific blank must be testable and capable of being proven false?

Answers: 1

Answer

Physics, 22.06.2019 18:00

By what primary heat transfer mechanism does the sun warm the earth?

Answers: 1

Answer

You know the right answer?

Discuss the limitations of using the doppler shift to determine an object's speed....