Physics, 22.08.2019 20:20 kevin72836

Two protons are 9.261 fm apart. (1 fm= 1 femtometer = 1 x 10^-15 m.) what is the ratio of the electric force to the gravitational force on one proton due to the other proton?

Answers: 1

Show answers

Answers

Answer from: lizzzzi7908

$F_e:F_g = 1:1.237 * 10^{36}$

Explanation:

Parameters given:

Distance between the protons, r = $1 * 10^{-15} m$

Electric charge of proton, Q = $1.602 * 10^{-19} C$

Mass of proton, m = $1.673 *10^{-27} kg$

The electric force on one proton due to the other given as:

$F_e = \frac{k*Q*Q}{r^2}$

where k = Coulomb's constant

$F_e = \frac{9 * 10^9 * 1.602 * 10^{-19} * 1.602 * 10^{-19} }{(1 * 10^{-15})^2} \\\\\\F_e = 230.98 N$

The gravitational force on one proton due to the other is given as:

$F_g = \frac{G*m*m}{r^2}$

where G = gravitational constant

$F_g = \frac{6.67408 * 10^{-11}*1.673 *10^{-27} * 1.673 *10^{-27}}{(1 * 10^{-15})^2} \\\\\\F_g = 1.868 * 10^{-34} N$

Therefore, the ratio of electric force, F_e , and gravitational force, F_g , is:

$\frac{F_e}{F_g} = \frac{230.98}{1.868 * 10^{-34}} = \frac{1}{1.237 * 10^{36}} \\\\\\F_e:F_g = 1:1.237 * 10^{36}$

Answer from: Quest

32: from largest to smallest, this hierarchy includes eons, eras, periods, epochs, and ages.

33: answer is c

i really hope this answer you out! it makes my day people like you and giving back to the community that has me through school! if you could do me a favor, if this you and this is the very best answer and you understand that all of my answers are legit and top notch. mark as brainliest! and have a awesome day!

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 04:20

Astone is thrown into a pond. what happens to the amplitude of the resulting waves as they get farther from the point where the stone hit the water? explain.

Answers: 3

Answer

Physics, 22.06.2019 07:50

The ratio of lift to drag l/d for a wing or airfoil is an important aerodynamic parameter, indeed, it is a direct measure of the aerodynamic efficiency of the wing. if a wing is pitched through a range of angle of attack, l/d first increases, then goes through a maximum, and then decreases. consider an infinite wing with an naca 2412 airfoil. estimate the maximum value of l/d. assume that the reynolds number is 9x10^6.

Answers: 2

Answer

Physics, 22.06.2019 09:30

1. how to locate the image in converging(concave) mirror and diverging (convex) mirror with salt. 2. how to locate the image in a converging (convex) lens and diverging (concave) lens with salt.

Answers: 1

Answer

Physics, 22.06.2019 10:00

Need people build a dam to create a reservoir that supplies water a nearby city needs. describe two ways this action will likely affect the water cycle in the local environment. (5 points) worth 20 points

Answers: 1

Answer

You know the right answer?

Two protons are 9.261 fm apart. (1 fm= 1 femtometer = 1 x 10^-15 m.) what is the ratio of the electr...

Questions