A. you might have heard of galileo’s famous experiment to demonstrate that all objects, regardless of their weight and assuming no air resistance, fall at the same acceleration. use newton’s second law of motion to show that for all objects, regardless of their mass, the acceleration due to gravity will be g, which we approximate as 9.8 m/s2.
b. given that the moon has a period of 27.32 days around earth and a radius of orbit which is 60 earth radii, what is the centripetal acceleration of the moon?
c. using newton’s law of gravity, find the acceleration of an object located 60 earth radii away due to the force of gravity from earth.
d.
objects in an elliptical orbit experience a different gravitational force because their distance is constantly changing. using figure 5, which shows the distance between two masses at a certain point in time, how would you calculate the x and y coordinates of the orbiting comet?
hint: put the origin at the location of the sun.
the image shows a commet orbiting aroung a sun in an oval shape. the sun is not in the center of the oval, but closer to the right side

Where are the options ?

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

1.state2.trash3.the earth