Mathematics, 14.10.2020 22:01 MarMarMar07

Sophie opened a picture of a tree on her cell phone screen and zoomed in 2.5 times. The new scale of the picture became 1:168. What would be the scale if it was zoomed in 4 times ?

Answers: 3

Show answers

Another question on Mathematics

Mathematics, 21.06.2019 16:30

I’m which figure is point g an orthocenter

Answers: 1

Answer

Mathematics, 21.06.2019 17:00

Why did the ice arena get so hot after the big game (this is math related google it to find the paper

Answers: 2

Answer

Mathematics, 21.06.2019 22:00

Two numbers have a sum of -19. one number is x. what expression represents the other number?

Answers: 2

Answer

Mathematics, 21.06.2019 22:10

What is the factor form of x^2-9x+14

Answers: 2

Answer

You know the right answer?

Sophie opened a picture of a tree on her cell phone screen and zoomed in 2.5 times. The new scale of...

Questions

Social Studies, 18.07.2019 01:00

The president is responsible for the communication and ongoing relationship between america and other nations of the world. this is known as: a. chec...

English, 18.07.2019 01:00

How might an unreliable narrator affect characterization in a work of short fiction? (plato) characterization would be accurate and truthful characte...

History, 18.07.2019 01:00

What is the relationship like with cuba and the u. s. today ?...

History, 18.07.2019 01:00

Why did the mongols fail to conquer japan in 1274 and 1281?...

Physics, 18.07.2019 01:00

Which of the following best describes the movement of an object at rest if no outside forces act on it...

Mathematics, 18.07.2019 01:00

In the figure ab equals how many inches ac equals how many inches...

Biology, 18.07.2019 01:00

Your science teacher brings in a speaker to talk to your class about climate change. during the session, students ask a few questions. which questions...

History, 18.07.2019 01:00

How did the treaty of versailles affect lands controlled by germany? a. germany lost colonies in europe and asia. b. germany gained lands in france a...

Spanish, 18.07.2019 01:00

complete the sentence with the correct form of comer: yo un burrito en el restaurante.comocomecomescomer...

Social Studies, 18.07.2019 01:00

Explicit and implicit rules that reflect social expectations and influence the way people behave in social situations are called...

Mathematics, 18.07.2019 01:00

The circumference of the earth is approximately 25,000 miles. what is this number expressed in scientific notation? a) 2.5 x 10^4 b) 2.5 x 10^3 c) 25...

Mathematics, 18.07.2019 01:00

What is 1 and 5/8 rounded to the nearest half...

Mathematics, 18.07.2019 01:00

Find the flux of the vector field v(x, y, z) = 7xy2i + 4x2yj + z3k out of the unit sphere....

Mathematics, 18.07.2019 01:00

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)s in(pi/6)...

Mathematics, 18.07.2019 01:00

Find the limit. use l'hospital's rule if appropriate. if there is a more elementary method, consider using it. lim x→4 x2 − 16 x2 − 4x...

Mathematics, 18.07.2019 01:00

Mary rent a truck from a truck-rental company that charges a flat fee of $20 and $5 per hour. if mary rents the truck for h hours, the expression that...

Computers and Technology, 18.07.2019 01:00

What is the largest component found inside a field?...

Mathematics, 18.07.2019 01:00

Find the maximum volume of a cylindrical soda can such that the sum of its height and its circumference is 120 cm....

Biology, 18.07.2019 01:00

Growth hormone (gh) promotes skeletal and muscle growth protein synthesis fat metabolism...

Biology, 18.07.2019 01:00

He blood vessels that permit the exchange of oxygen, carbon dioxide, nutrients, and waste products with body cells are the...

More questions: Mathematics Another questions