Chemistry, 25.07.2019 23:30 blessing5266

Calculate the ph of 0.726 m anilinium hydrochloride (c6h5nh3cl) solution in water, given that kb for aniline is 3.83 x 10-4.

Answers: 1

Show answers

Answers

Answer from: psychocatgirl1

The pH of 0.726 M anilinium hydrochloride solution in water is 5.36.

C₆H₅NH₃Cl dissociates completely in water according to the following equation.

C₆H₅NH₃Cl(aq) ⇒ C₆H₅NH₃⁺(aq) + Cl⁻(aq)

Cl⁻ is a very weak base so it can't react with water, whereas C₆H₅NH₃⁺ reacts with water according to the following acid equation.

C₆H₅NH₃⁺(aq) + H₂O(l) ⇒ C₆H₅NH₂(aq) + H₃O⁺

Given Kb for C₆H₅NH₂ is 3.83 × 10⁻⁴, we can calculate Ka for C₆H₅NH₃⁺ using the following expression.

$Ka \times Kb = Kw\\\\Ka = \frac{Kw}{Kb} = \frac{1.00 \times 10^{-14} }{3.83 \times 10^{-4} } = 2.61 \times 10^{-11}$

Given the concentration of C₆H₅NH₃⁺ (Ca) is 0.726 M and the acid dissociation constant (Ka) is 2.61 × 10⁻¹¹, we can calculate [H⁺] using the following expression.

$[H^{+} ] = \sqrt{Ka \times Ca } = \sqrt{(2.61 \times 10^{-11} ) \times 0.726 } = 4.35 \times 10^{-6} M$

The pH of the solution is:

$pH = -log[H^{+} ] = -log (4.35 \times 10^{-6}) = 5.36$

The pH of 0.726 M anilinium hydrochloride solution in water is 5.36.

Learn more: link

Calculate the pH of 0.726 M anilinium hydrochloride (C₆H₅NH₃Cl) solution in water, given that Kb for aniline is 3.83 × 10⁻⁴.

Answer from: liltonio

First, we have to get Ka:

when Ka = Kw / Kb and we have Kb = 3.83 x 10^-4 & Kw = 1 x 10^-14

∴Ka = (1 x 10^-14) / (3.83 x 10^-4)

= 2.6 x 10^-11

according to the reaction equation:

by using ICE table:

C6H5NH3+ + H2O ↔ C6H5NH2 + H3O+

initial 0.726 0 0

change -X +X +X

Equ (0.726 -X) X X

when Ka = [C6H5NH2][H3O+]/[C6H5NH3+]

by substitution:

2.6 x 10^-11 = X*X / (0.726 -X) by solving for X

∴X = 4.3 x 10^-6

when [H3O+] = X = 4.3 x 10^-6

∴PH = -㏒[H3O+]

= -㏒(4.3 x 10^-6)

= 5.4

Answer from: Quest

explanation:

mitosis

Answer from: Quest

i'm pretty sure its b i might be wrong though!

Another question on Chemistry

Chemistry, 22.06.2019 03:20

Which type of substance ionizes partially and gives off hydrogen ions when dissolved in water? a. strong acid b. strong base c. weak acid d. weak base

Answers: 1

Answer

Chemistry, 22.06.2019 05:30

What royal scientist used the 29th day of frozen vapor to encounter elements for mastering new culinary creations?

Answers: 1

Answer

Chemistry, 22.06.2019 08:00

Straightforward questions answered in the powerpoint slidesreaction: heating the starting materials under refluxwhat does it mean to heat under reflux? why do we choose water as the reflux solvent? what are boiling chips used for? why do we put a condenser on top of the reaction? why do we add heat and let the reaction stir for 30 minutes? why do we add sulfuric acid to the reaction after it cools as opposed to when it’s still hot? separation: filtration of precipitatewhy don’t we do an aqueous and organic extraction in the separatory funnel? why do you rinse the salicylic acid on the filter with ice cold water? purification: recrystallization of salicylic acid (no hot filtration needed)what is the difference in the amount of room temperature water vs. boiling water needed to dissolve the salicylic acid (assume a 1.2 gram yield of salicylic acid)? remember, in the lab if you need x ml of boiling water to dissolve a solid, then you should add a little more (definitely no more than 1.5 times the theoretical amount) to ensure it doesn’t recrystallize prematurely.analysis: melting point of salicylic acidwhat can you conclude if the melting point of the salicylic acid you just synthesized is 152-155oc and the 1: 1 mix of your product and “synthetic” salicylic acid is 151-154oc?

Answers: 1

Answer

Chemistry, 22.06.2019 14:10

16. in a reaction that has reached equilibrium, a. the forward and reverse reactions are occurring at the same rate. b. the reactants and products are in equal concentrations. c. the forward reaction has gone further than the reverse reaction. d. there are equal numbers of atoms on both sides of the equation. e. a, b, and d are correct.

Answers: 2

Answer

You know the right answer?

Calculate the ph of 0.726 m anilinium hydrochloride (c6h5nh3cl) solution in water, given that kb for...

Questions