Balance Ni(NO3)2+Na2CrO4=NiCrO4+Na(NO3)2

What is the correct lewis structure for chloroform chcl3

This classification of drug typically changes the brain's chemistry and reduces its ability to create its own endorphins.

Balance and in which category does it fit in? single or double displacement or synthesis or decomposition? (a) k2 o → k + o2 (b) na + i2 → nai (c) cu(no3 )2 + naoh → cu(oh)2 + nano3 (d) kclo3 → kcl + o2 (e) ca(no3 )2 + hbr → cabr2 + hno3 (f) sn(oh)2 → sno + h2 o (g) p4 + n2 o → p4 o6 + n2 (h) fe + al2 (so4 )3 → feso4 + al (i) alcl3 + na2 co3 → al2 (co3 )3 + nacl (j) c3 h6 + o2 → co2 + h2 o