Photolithography is the process by which we make the tiny circuits necessary for the tiny transistors in today’s electronics. To do this we must create very thin films of a chemical burn carveout channels that are filled with metal to creat the circuits. One posible candidate for making these thin films is butyltin trichloride, C4H9SnCl3. In the presence water this chemical loosens some of its bound chloride atoms producing hydrochloric acid HCI, arrording to the chemical equation below C4H9SnCl3+H2O=C4H9Sn(OH)2Cl+HCl

Water is important for the of cells. a: size, shape, and temperature b: temperature, color, and odor c: color, odor, and size d: shape, temperature, and color

Darla claims that the first periodic table developed by mendeleev was not completely accurate, so it is not useful at all. harmony argues that it establish the periodic table we use today, making it more credible. who is correct and why? darla is correct, because a model that has any mistakes should be thrown out. darla is correct, because a good model would not need to change. harmony is correct, because mendeleev’s model had all of the information correct in the first version. harmony is correct, because mendeleev’s model made predictions that came true.

Write a hypothesis that answers the lesson question, “while observing a chemical reaction, how can you tell which reactant is limiting? ” hypothesis: if a substance is the limiting reactant, then . . because . .