What is the IUPAC name for Ch3Ch(Cl)Ch2Ch(Ch3)Ch2Ch3

Nonpoint source pollution is difficult to control because it

An atom's configuration based on its number of electrons ends at 3p4. another atom has seven more electrons. starting at 3p, what is the remaining configuration? 3p63d34s2 3p43d54s2 3p64s23d3 3p44s23d

According to the valence shell electron pair repulsion (vsepr) theory, a molecule that has four electron groups around the central atom will exhibit what electron geometry? view available hint(s) according to the valence shell electron pair repulsion (vsepr) theory, a molecule that has four electron groups around the central atom will exhibit what electron geometry? trigonal bipyramidal tetrahedral square planar determination of electron geometry requires information on whether the electron groups are lone pairs or bonding groups.