Draw this molecule in the form of bond line figure.

CHOCH2CH(CH2CH3)CON(CH3)2

What semimetal can form four single covalent bonds.

Consider the following reaction at equilibrium. 2co2 (g) 2co (g) + o2 (g) h° = -514 kj le châtelier's principle predicts that the equilibrium partial pressure of co (g) can be maximized by carrying out the reaction a. at high temperature and high pressure b. at high temperature and low pressure c. at low temperature and low pressure d. at low temperature and high pressure e. in the presence of solid carbon

For the reaction shown, calculate how many moles of no2 form when each of the following completely reacts. 2n2o5(g)→4no2(g)+o2(g) part a 1.0 mol n2o5 express your answer using two significant figures. nothing mol m o l request answer part b 5.4 mol n2o5 express your answer using two significant figures.