Ca(No3)2+H3PO4=Ca(PO4)2+HNO3 balance

In 1901, thomas edison invented the nickel-iron battery. the following reaction takes place in the battery. fe(s) + 2 nio(oh)(s) + 2 h2o(l) fe(oh)2(s) + 2 ni(oh)2(aq) how many mole of fe(oh)2, is produced when 5.35 mol fe and 7.65 mol nio(oh) react?

Great amounts of electromagnetic energy from our sun and other bodies in space travel through space. which is a logical conclusion about these electromagnetic waves? their energy must be very their frequency must be very low these waves can travel without a medium they only travel through a vacuum of space

What is the mass of naoh that would have to be added to 500 ml of a solution of 0.20 m acetic acid in order to achieve a ph of 5.0?