Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type

The conventional equilibrium constant expression (kc) for the system below is: 2icl(s) ⇄ i2(s) + cl2(g) [cl2] ([i2] + [cl2])/2[icl] [i2][cl2]/[icl]2 none of the listed answers are correct [i2][cl2]/2[icl]

3. how much energy in joules is required to evaporate .0005 kg of liquid ammonia to vapor at the same temperature? 4. how much energy ( in megajoules ) is given up by .75 kg of water at 0c when it freezes to form ice at 0c? 5. explain how heat works between and at critical temperatures?

If oil spills continue, all of the following should be expected except (2 points) death of aquatic life. polluted groundwater. decreased soil productivity. increased global temperatures.