Select any and all of these molecules that have at least one chiral carbon atom. Group of answer choices 3,4-dimethylhexane 3,3-dimethylpentane CH3CH2CH(OH)CH3 CH3CH2CH(CH3)CH2CH2CH3 CH3C(CH3)2CH(CH2CH3)C(CH3)3

3,4-dimethylhexane, CH3CH2CH(OH)CH3, CH3CH2CH(CH3)CH2CH2CH3

Explanation:

A chiral carbon atom is also referred to as a asymmetric carbon atom. This is a carbon atom that is bonded to four different substituents.

So what we need to do is to look at each compound and consider all the carbon atoms in each compound. Drawing out the full structural formula is very helpful here.

After drawing each structure out, we now look out for carbon atoms that have four dissimilar substituents. Those are the chiral carbons. If we do so for all the molecules listed in the answer, we will discover that each of them contains an asymmetric carbon atom.

why is arctic sea ice important? arctic sea ice keeps the polar regions cool and moderate global climate. sea ice has a bright surface; 80 percent of the sunlight that strikes it is reflected back into space. as sea ice melts in the summer, it exposes the dark ocean surface.