6 mol of hydrogel gas Tu
The decomposition of potassium chlorate, KCIO3, into KCl and O2
is used as a source of oxygen in the laboratory. How many moles of
potassium chlorate are needed to produce 15 mol of oxygen gas?

9.0 mol

Potassium chlorate KClO 3 decomposes to produce potassium chloride KCl and oxygen O2. Balancing the equation KClO3→KCl+O2 (not balanced) based on the fact that the number of moles of oxygen atoms should be the same on both side of the equation will give KClO3→KCl+32O22KClO3→2KCl+3O2 Hence the ratio of number of moles of particles n(O2)n(KClO3)=32n(O2)=n(KClO3)⋅n(O2)n(KClO3)=32⋅

n(KClO3)Therefore the decomposition of 6.0l mol

of KClO 3 would yield 6.0⋅n

(O2)n(KClO 3)=6.0⋅ 32=9.0l molNote that the species KCl is highly stable. Both the potassium cation K+ and the chloride anion Cl− have attained a noble gas octet configuration of valence shell electrons. Chemical reactions tend to favor the most chemically stable combination. Therefore this decomposition reaction would eventually produce

KCl rather than other salts that contain oxygen.

answer: a chemical reaction

explanation:

im not wrong