The chelate effect can be partially explained in terms of the entropy change involved in chelation reactions. the reaction forming coedta? from the hexaaqua complex of co3+,co(h2o)63+(aq) + edta4-(aq) ? coedta-(aq)+ 6h2o(l)leads to a net increase in the number of particles in the solution. part a: in which of the following reactions will the entropy change, ? s, be a positive value? a. caedta? (aq)+3en(aq)? ca(en)33(aq)+edta4? (aq)b. cu(h2o)62+(aq)+3nh3(aq)? cu(h2o)3(nh3)32+(aq)+3h2o(l)c. co(nh3)4(acac)3+(aq)+2acac(aq)? co(acac)33+(aq)+3nh3(aq)d. zncl2(en)(aq)+4oh? (aq)? zn(oh)2? 4(aq)+2cl? (aq)+en(aq)e. fecl64? (aq)+edta4? (aq)? feedta2? (aq)+6cl? (aq)