Convert the condensed structures to line angle formulas: 1. ch3ch2ch(ch3)ch2ch3 8. ch: coch 9. ch3ch2och3 2. ch3ch2ch(ch2ch3)ch(ch3)ch2cho ch)ch: ch-ch: 10. ch ch2ch=c(ch: ch)(c(ch))ch 3. ch3ch2ch(ch3)ch(ch3)ch2ch3 11. ch: ch-ch(ch2ch)ch oh 4. ch3c(ch3)2ch2ch2ch(ch3)ch2ch3 12. chchoch2cho 5. ch(ch3)2ch(ci)ch2ch3 13. hoocch2nhch(ch3)coch; 6. ch3ch2choch(ch2ch3)ch2ch3 14. hoocch och cooh 7. hoch: c(ch3)2conh2

Attached in the photo.

Explanation:

Hello,

The answers in the attached photo. Just three things:

- In the second point a parenthesis is missing to properly understand the molecule (after the oxygen), nevertheless, I assumed it was an ether.

- In the sixth point, there's a missing hydrogen for it to be an ether as well.

- In the tenth point the second parenthesis is not clear, it seems there's a missing subscript, nevertheless I draw it assuming complete octates.

Best regards.

both adhesion and cohesion are attractions.

they are different in that adhesion is the force of attraction between the molecules of two different substances, whereas cohesion is the force of attraction between molecules of the same substance.

possible examples include capillary action, in which the adhesion between water and glass causes the water to rise in a narrow tube against the force of gravity.

because of hydrogen bonding, water is extremely cohesive.

this causes molecules on the surface of water to be drawn inward, which is why drops of water form beads on smooth surfaces.

hope this .