![subject](/tpl/images/cats/himiya.png)
Chemistry, 28.09.2019 03:20 taylorrsmithh
Dielectrics 583 reflect as w creases when the es some energy sct as we would expect, the potential difference when the capacitors are connected because the first me across c de energy to the second one. since the two capacitors have the the first capacitor are in parallel, but the concept of an equivalent capaci- came they are in converted to other forms: the conductors become a little warmer, and some energy is radiated as electromagnetic waves. we'll study these phenomena in later chapters practice problem: in this example, if c = 80 mf (equal to c). what fraction of the original stored energy remains after c is connected to c ?50%. ce is not needed here. see that the final stored energy is only 65% of the initial value. moves to the new capacitor, some of the stored energy is as charge moves to 18.7 dielectrics
convert the condensed structures to line angle formulas: 1. ch3ch2ch(ch3)ch2ch3 8. chcoch 9. ch3ch2och3 2. ch3ch2ch(ch2ch3)ch(ch3)ch2cho ch)ch: chch: 10. ch ch2ch=c(ch: chb)(c(ch3)3)ch, 3. ch3ch2ch(ch3)ch(ch3)ch2ch3 11. ch: ch-ch(ch2ch)ch oh 4. ch3c(ch3)2ch2ch2ch(ch3)ch2ch3 12. ch3ch2och2cho 5. ch(ch3)2ch(ci)ch2ch3 13. hoocch2nhch(ch3)coch3 6. ch3ch2ch och(ch2ch3)ch2ch3 14. hoocch och cooh 7. hoch: c(ch3)2conh2
![ansver](/tpl/images/cats/User.png)
Answers: 3
![](/tpl/images/ask_question.png)
![](/tpl/images/ask_question_mob.png)
Another question on Chemistry
![question](/tpl/images/cats/himiya.png)
Chemistry, 21.06.2019 13:00
Compare these two waves : a. the blue wave has a higher pitch, but the orange wave is louder. b.the blue and orange waves have the same volume, but the blue wave has a higher pitch. c.the blue and orange waves have the same pitch, but the blue wave is louder. d.the orange wave has a higher pitch, but the blue wave is louder.
Answers: 1
![question](/tpl/images/cats/himiya.png)
Chemistry, 22.06.2019 02:40
Achange in the number of neutrons in an atom will change an blank . when the number of protons changes in an atom, a new element will form.
Answers: 2
![question](/tpl/images/cats/himiya.png)
Chemistry, 22.06.2019 04:50
Write the overall equation for the reaction for lithium battery
Answers: 2
![question](/tpl/images/cats/himiya.png)
Chemistry, 22.06.2019 10:30
Acompound has a molar mass of 92.02 grams/mole, and its percent composition is 30.4% nitrogen (n) and 69.6% oxygen (o). what is its molecular formula? a. n2o4 b. no2 c. n2o d. n4o2
Answers: 1
You know the right answer?
Dielectrics 583 reflect as w creases when the es some energy sct as we would expect, the potential d...
Questions
![question](/tpl/images/cats/mat.png)
![question](/tpl/images/cats/pravo.png)
![question](/tpl/images/cats/fizika.png)
Physics, 07.12.2020 04:40
![question](/tpl/images/cats/geografiya.png)
Geography, 07.12.2020 04:40
![question](/tpl/images/cats/mat.png)
Mathematics, 07.12.2020 04:40
![question](/tpl/images/cats/mat.png)
![question](/tpl/images/cats/ekonomika.png)
![question](/tpl/images/cats/himiya.png)
Chemistry, 07.12.2020 04:40
![question](/tpl/images/cats/mat.png)
![question](/tpl/images/cats/mat.png)
Mathematics, 07.12.2020 04:40
![question](/tpl/images/cats/mat.png)
Mathematics, 07.12.2020 04:40
![question](/tpl/images/cats/himiya.png)
![question](/tpl/images/cats/en.png)
English, 07.12.2020 04:40
![question](/tpl/images/cats/mat.png)
Mathematics, 07.12.2020 04:50
![question](/tpl/images/cats/mat.png)
![question](/tpl/images/cats/ekonomika.png)
![question](/tpl/images/cats/obshestvoznanie.png)
![question](/tpl/images/cats/obshestvoznanie.png)
Social Studies, 07.12.2020 04:50
![question](/tpl/images/cats/mat.png)
Mathematics, 07.12.2020 04:50