Spermine (structure shown) is a compound isolated from sperm. which of the following statements correctly describes an aqueous solution of spermine?
nh2(ch2)3nh(ch2)4nh(ch2)3nh2
question 2 options:
a)
the hydroxide ion concentration in the solution would be greater than that in pure water.
b)
the hydronium ion concentration in the solution would be greater than that in pure water.
c)
the solution would be acidic.
d)
the ph of the solution would be equal to that of pure water.

If the particles in a sample of matter have an orderly arrangement and move only in place, the sample is a

1) this is the structure in the cell nucleus that houses a cell's genetic information

Sarah wants to know where in her garden chamomile would grow the best. she thinks chamomile will grow best in the corner of the garden that gets the most sunlight. to test her hypothesis, she decides to plant several groups of chamomile in her garden as an experiment. which of the following variables will sarah need to measure to know which group of plants grew best? a. the location of the plants b. the type of plants c. the height of the plants d. the amount of water she gives the plants